C24H46N4O4 — CID 90223974
3-[(3'S,4'aR,8'aR)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea (PubChem CID 90223974) has the molecular formula C24H46N4O4 and a molecular weight of 454.66 g/mol. Its IUPAC name is 3-[(3'S,4'aR,8'aR)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea.
| Compound Name | 3-[(3'S,4'aR,8'aR)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 90223974 |
| Molecular Formula | C24H46N4O4 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | 3-[(3'S,4'aR,8'aR)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea |
| SMILES | CCCN1C[C@@H](NC(=O)N(CC)CCN(C)CCCOC)C[C@@H]2CC3(CC[C@H]21)OCCO3 |
| InChI | InChI=1S/C24H46N4O4/c1-5-10-28-19-21(17-20-18-24(9-8-22(20)28)31-15-16-32-24)25-23(29)27(6-2)13-12-26(3)11-7-14-30-4/h20-22H,5-19H2,1-4H3,(H,25,29)/t20-,21+,22-/m1/s1 |
| InChIKey | FGKFBIFBJOKSQD-BHIFYINESA-N |
| XLogP | 2.38 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|