C55H64BN3O2S3 — CID 90224003
4-[5-[9-heptadecan-9-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-2-yl]thiophen-2-yl]-7-(5-phenylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 90224003) has the molecular formula C55H64BN3O2S3 and a molecular weight of 906.15 g/mol. Its IUPAC name is 4-[5-[9-heptadecan-9-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-2-yl]thiophen-2-yl]-7-(5-phenylthiophen-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[9-heptadecan-9-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-2-yl]thiophen-2-yl]-7-(5-phenylthiophen-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 90224003 |
| Molecular Formula | C55H64BN3O2S3 |
| Molecular Weight | 906.15 g/mol |
| Exact Mass | 905.43 |
| IUPAC Name | 4-[5-[9-heptadecan-9-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-2-yl]thiophen-2-yl]-7-(5-phenylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCC(CCCCCCCC)n1c2cc(B3OC(C)(C)C(C)(C)O3)ccc2c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccccc6)s5)c5nsnc45)s3)cc21 |
| InChI | InChI=1S/C55H64BN3O2S3/c1-7-9-11-13-15-20-24-41(25-21-16-14-12-10-8-2)59-46-36-39(26-28-42(46)43-29-27-40(37-47(43)59)56-60-54(3,4)55(5,6)61-56)49-33-35-51(63-49)45-31-30-44(52-53(45)58-64-57-52)50-34-32-48(62-50)38-22-18-17-19-23-38/h17-19,22-23,26-37,41H,7-16,20-21,24-25H2,1-6H3 |
| InChIKey | SQYAHMIZZMMXOI-UHFFFAOYSA-N |
| XLogP | 16.93 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.15 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|