C22H42N4O3 — CID 90224090
3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea (PubChem CID 90224090) has the molecular formula C22H42N4O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea.
| Compound Name | 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 90224090 |
| Molecular Formula | C22H42N4O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea |
| SMILES | CCCN1C[C@@H](NC(=O)N(CC)CCN(C)CCCOC)C[C@@H]2CC(=O)CC[C@H]21 |
| InChI | InChI=1S/C22H42N4O3/c1-5-10-26-17-19(15-18-16-20(27)8-9-21(18)26)23-22(28)25(6-2)13-12-24(3)11-7-14-29-4/h18-19,21H,5-17H2,1-4H3,(H,23,28)/t18-,19+,21-/m1/s1 |
| InChIKey | QRAHQINJHSSQNL-SVFBPWRDSA-N |
| XLogP | 2.21 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|