About 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol
4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol (PubChem CID 90224129) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol.
Molecular Properties
| Compound Name | 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol |
| PubChem CID | 90224129 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol |
| SMILES | C=C(O)CCC(CCC(O)OC(C)C)[C@@H](C)O |
| InChI | InChI=1S/C13H26O4/c1-9(2)17-13(16)8-7-12(11(4)15)6-5-10(3)14/h9,11-16H,3,5-8H2,1-2,4H3/t11-,12?,13?/m1/s1 |
| InChIKey | YHNVKWWSVABCLD-PNESKVBLSA-N |
| XLogP | 2.36 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol?
The IUPAC name of 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol (CID 90224129) is 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol.
What is the SMILES notation for 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol?
The canonical SMILES for 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol is C=C(O)CCC(CCC(O)OC(C)C)[C@@H](C)O.
What is the InChIKey of 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol?
The InChIKey is YHNVKWWSVABCLD-PNESKVBLSA-N. The full InChI is InChI=1S/C13H26O4/c1-9(2)17-13(16)8-7-12(11(4)15)6-5-10(3)14/h9,11-16H,3,5-8H2,1-2,4H3/t11-,12?,13?/m1/s1.
What are the key properties of 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol?
4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol has a molecular weight of 246.35 g/mol, XLogP of 2.36, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-1-hydroxyethyl]-1-propan-2-yloxyoct-7-ene-1,7-diol is sourced from PubChem (CID 90224129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).