C20H34N6O2 — CID 90224175
3-[(5aR,8S,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-(3-methoxypropyl)-1-methylurea (PubChem CID 90224175) has the molecular formula C20H34N6O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[(5aR,8S,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-(3-methoxypropyl)-1-methylurea.
| Compound Name | 3-[(5aR,8S,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-(3-methoxypropyl)-1-methylurea |
|---|---|
| PubChem CID | 90224175 |
| Molecular Formula | C20H34N6O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 3-[(5aR,8S,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-(3-methoxypropyl)-1-methylurea |
| SMILES | CCCN1C[C@@H](NC(=O)N(C)CCCOC)C[C@@H]2Cc3nc(N)ncc3C[C@H]21 |
| InChI | InChI=1S/C20H34N6O2/c1-4-6-26-13-16(23-20(27)25(2)7-5-8-28-3)9-14-10-17-15(11-18(14)26)12-22-19(21)24-17/h12,14,16,18H,4-11,13H2,1-3H3,(H,23,27)(H2,21,22,24)/t14-,16+,18-/m1/s1 |
| InChIKey | YJOGTDSESBPLSW-UWWQBHOKSA-N |
| XLogP | 1.30 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|