C17H29N3O2 — CID 90224198
3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-cyclopropyl-1-methylurea (PubChem CID 90224198) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-cyclopropyl-1-methylurea.
| Compound Name | 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-cyclopropyl-1-methylurea |
|---|---|
| PubChem CID | 90224198 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-cyclopropyl-1-methylurea |
| SMILES | CCCN1C[C@@H](NC(=O)N(C)C2CC2)C[C@@H]2CC(=O)CC[C@H]21 |
| InChI | InChI=1S/C17H29N3O2/c1-3-8-20-11-13(18-17(22)19(2)14-4-5-14)9-12-10-15(21)6-7-16(12)20/h12-14,16H,3-11H2,1-2H3,(H,18,22)/t12-,13+,16-/m1/s1 |
| InChIKey | ZRAPCABPBKRPIA-DVOMOZLQSA-N |
| XLogP | 2.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |