C21H40N4O2 — CID 90224199
3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-[2-(diethylamino)ethyl]-1-ethylurea (PubChem CID 90224199) has the molecular formula C21H40N4O2 and a molecular weight of 380.58 g/mol. Its IUPAC name is 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-[2-(diethylamino)ethyl]-1-ethylurea.
| Compound Name | 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-[2-(diethylamino)ethyl]-1-ethylurea |
|---|---|
| PubChem CID | 90224199 |
| Molecular Formula | C21H40N4O2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | 3-[(3S,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-[2-(diethylamino)ethyl]-1-ethylurea |
| SMILES | CCCN1C[C@@H](NC(=O)N(CC)CCN(CC)CC)C[C@@H]2CC(=O)CC[C@H]21 |
| InChI | InChI=1S/C21H40N4O2/c1-5-11-25-16-18(14-17-15-19(26)9-10-20(17)25)22-21(27)24(8-4)13-12-23(6-2)7-3/h17-18,20H,5-16H2,1-4H3,(H,22,27)/t17-,18+,20-/m1/s1 |
| InChIKey | LULUEDJLXWVMFQ-WSTZPKSXSA-N |
| XLogP | 2.58 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |