C26H24BF6NO2 — CID 90224362
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,N-bis[4-(trifluoromethyl)phenyl]aniline (PubChem CID 90224362) has the molecular formula C26H24BF6NO2 and a molecular weight of 507.28 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,N-bis[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,N-bis[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 90224362 |
| Molecular Formula | C26H24BF6NO2 |
| Molecular Weight | 507.28 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,N-bis[4-(trifluoromethyl)phenyl]aniline |
| SMILES | CC1(C)OB(c2ccc(N(c3ccc(C(F)(F)F)cc3)c3ccc(C(F)(F)F)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C26H24BF6NO2/c1-23(2)24(3,4)36-27(35-23)19-9-15-22(16-10-19)34(20-11-5-17(6-12-20)25(28,29)30)21-13-7-18(8-14-21)26(31,32)33/h5-16H,1-4H3 |
| InChIKey | DFIDGRIBLWJYLW-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.28 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|