C33H23BrN4 — CID 90224374
N-[4-(6-bromopyren-1-yl)phenyl]-4,6-dimethyl-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 90224374) has the molecular formula C33H23BrN4 and a molecular weight of 555.48 g/mol. Its IUPAC name is N-[4-(6-bromopyren-1-yl)phenyl]-4,6-dimethyl-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | N-[4-(6-bromopyren-1-yl)phenyl]-4,6-dimethyl-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 90224374 |
| Molecular Formula | C33H23BrN4 |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | N-[4-(6-bromopyren-1-yl)phenyl]-4,6-dimethyl-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(C)nc(N(c2ccccc2)c2ccc(-c3ccc4ccc5c(Br)ccc6ccc3c4c65)cc2)n1 |
| InChI | InChI=1S/C33H23BrN4/c1-20-35-21(2)37-33(36-20)38(25-6-4-3-5-7-25)26-14-8-22(9-15-26)27-16-10-23-12-18-29-30(34)19-13-24-11-17-28(27)31(23)32(24)29/h3-19H,1-2H3 |
| InChIKey | PICIUXLCHJPUKQ-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|