C25H11F3O6 — CID 90224449
2-phenyl-2-(trifluoromethyl)-7,17-dioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone (PubChem CID 90224449) has the molecular formula C25H11F3O6 and a molecular weight of 464.35 g/mol. Its IUPAC name is 2-phenyl-2-(trifluoromethyl)-7,17-dioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone.
| Compound Name | 2-phenyl-2-(trifluoromethyl)-7,17-dioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 90224449 |
| Molecular Formula | C25H11F3O6 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 2-phenyl-2-(trifluoromethyl)-7,17-dioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone |
| SMILES | O=C1OC(=O)c2cc3c(cc21)Cc1cc2c(cc1C3(c1ccccc1)C(F)(F)F)C(=O)OC2=O |
| InChI | InChI=1S/C25H11F3O6/c26-25(27,28)24(13-4-2-1-3-5-13)18-9-16-14(20(29)33-22(16)31)7-11(18)6-12-8-15-17(10-19(12)24)23(32)34-21(15)30/h1-5,7-10H,6H2 |
| InChIKey | MOANTZJVCMFSRB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|