About (10-isocyanato-3,8-dimethyldecyl) cyanate
(10-isocyanato-3,8-dimethyldecyl) cyanate (PubChem CID 90224520) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is (10-isocyanato-3,8-dimethyldecyl) cyanate.
Molecular Properties
| Compound Name | (10-isocyanato-3,8-dimethyldecyl) cyanate |
| PubChem CID | 90224520 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (10-isocyanato-3,8-dimethyldecyl) cyanate |
| SMILES | CC(CCCCC(C)CCOC#N)CCN=C=O |
| InChI | InChI=1S/C14H24N2O2/c1-13(7-9-16-12-17)5-3-4-6-14(2)8-10-18-11-15/h13-14H,3-10H2,1-2H3 |
| InChIKey | YOASSWIJGRPICT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (10-isocyanato-3,8-dimethyldecyl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-isocyanato-3,8-dimethyldecyl) cyanate?
The IUPAC name of (10-isocyanato-3,8-dimethyldecyl) cyanate (CID 90224520) is (10-isocyanato-3,8-dimethyldecyl) cyanate.
What is the SMILES notation for (10-isocyanato-3,8-dimethyldecyl) cyanate?
The canonical SMILES for (10-isocyanato-3,8-dimethyldecyl) cyanate is CC(CCCCC(C)CCOC#N)CCN=C=O.
What is the InChIKey of (10-isocyanato-3,8-dimethyldecyl) cyanate?
The InChIKey is YOASSWIJGRPICT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-13(7-9-16-12-17)5-3-4-6-14(2)8-10-18-11-15/h13-14H,3-10H2,1-2H3.
What are the key properties of (10-isocyanato-3,8-dimethyldecyl) cyanate?
(10-isocyanato-3,8-dimethyldecyl) cyanate has a molecular weight of 252.36 g/mol, XLogP of 3.43, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (10-isocyanato-3,8-dimethyldecyl) cyanate is sourced from PubChem (CID 90224520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).