C19H36O5 — CID 90224521
(3aR,4R,5R,6aS)-4-(3,3-dimethoxydecyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 90224521) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-(3,3-dimethoxydecyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-(3,3-dimethoxydecyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 90224521 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-(3,3-dimethoxydecyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | CCCCCCCC(CC[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1O)(OC)OC |
| InChI | InChI=1S/C19H36O5/c1-4-5-6-7-8-10-19(22-2,23-3)11-9-14-15-12-18(21)24-17(15)13-16(14)20/h14-18,20-21H,4-13H2,1-3H3/t14-,15-,16-,17+,18?/m1/s1 |
| InChIKey | UDDFQVYCBBQQAU-VQVIJEGRSA-N |
| XLogP | 3.22 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|