C16H23F5O4SSi — CID 90224564
dimethoxy-methyl-[2-[4-(2,2,4,4,4-pentafluorobutylsulfonylmethyl)phenyl]ethyl]silane (PubChem CID 90224564) has the molecular formula C16H23F5O4SSi and a molecular weight of 434.50 g/mol. Its IUPAC name is dimethoxy-methyl-[2-[4-(2,2,4,4,4-pentafluorobutylsulfonylmethyl)phenyl]ethyl]silane.
| Compound Name | dimethoxy-methyl-[2-[4-(2,2,4,4,4-pentafluorobutylsulfonylmethyl)phenyl]ethyl]silane |
|---|---|
| PubChem CID | 90224564 |
| Molecular Formula | C16H23F5O4SSi |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | dimethoxy-methyl-[2-[4-(2,2,4,4,4-pentafluorobutylsulfonylmethyl)phenyl]ethyl]silane |
| SMILES | CO[Si](C)(CCc1ccc(CS(=O)(=O)CC(F)(F)CC(F)(F)F)cc1)OC |
| InChI | InChI=1S/C16H23F5O4SSi/c1-24-27(3,25-2)9-8-13-4-6-14(7-5-13)10-26(22,23)12-15(17,18)11-16(19,20)21/h4-7H,8-12H2,1-3H3 |
| InChIKey | BDGODCUYZXQVQN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|