About 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide
1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide (PubChem CID 90224660) has the molecular formula C6H8ClF2NO
and a molecular weight of 183.58 g/mol. Its IUPAC name is 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide |
| PubChem CID | 90224660 |
| Molecular Formula | C6H8ClF2NO |
| Molecular Weight | 183.58 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCC(F)F)C1(Cl)CC1 |
| InChI | InChI=1S/C6H8ClF2NO/c7-6(1-2-6)5(11)10-3-4(8)9/h4H,1-3H2,(H,10,11) |
| InChIKey | LZFULVRNOVMABI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.58 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide?
The IUPAC name of 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide (CID 90224660) is 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide.
What is the SMILES notation for 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide?
The canonical SMILES for 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide is O=C(NCC(F)F)C1(Cl)CC1.
What is the InChIKey of 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide?
The InChIKey is LZFULVRNOVMABI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClF2NO/c7-6(1-2-6)5(11)10-3-4(8)9/h4H,1-3H2,(H,10,11).
What are the key properties of 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide?
1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide has a molecular weight of 183.58 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 90224660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).