C21H26O2 — CID 90224703
2-dodeca-4,9-diynyl-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 90224703) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-dodeca-4,9-diynyl-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-dodeca-4,9-diynyl-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 90224703 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-dodeca-4,9-diynyl-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCC#CCCCC#CCCCC1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C21H26O2/c1-5-6-7-8-9-10-11-12-13-14-15-19-18(4)20(22)16(2)17(3)21(19)23/h5,8-10,13-15H2,1-4H3 |
| InChIKey | RLYJRMUXUOMOKB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|