C21H24S3 — CID 90225313
4,9,14-tri(propan-2-yl)-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene (PubChem CID 90225313) has the molecular formula C21H24S3 and a molecular weight of 372.62 g/mol. Its IUPAC name is 4,9,14-tri(propan-2-yl)-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene.
| Compound Name | 4,9,14-tri(propan-2-yl)-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
|---|---|
| PubChem CID | 90225313 |
| Molecular Formula | C21H24S3 |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4,9,14-tri(propan-2-yl)-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
| SMILES | CC(C)c1cc2c(s1)c1cc(C(C)C)sc1c1cc(C(C)C)sc21 |
| InChI | InChI=1S/C21H24S3/c1-10(2)16-7-13-19(22-16)14-8-17(11(3)4)24-21(14)15-9-18(12(5)6)23-20(13)15/h7-12H,1-6H3 |
| InChIKey | AQKHQEXHZUSRJI-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |