C18H21F2N3O — CID 90225444
(E)-1-(4,4-difluoroazepan-1-yl)-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one (PubChem CID 90225444) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is (E)-1-(4,4-difluoroazepan-1-yl)-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4,4-difluoroazepan-1-yl)-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90225444 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (E)-1-(4,4-difluoroazepan-1-yl)-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one |
| SMILES | C=C1CCc2cc(/C=C/C(=O)N3CCCC(F)(F)CC3)cnc2N1 |
| InChI | InChI=1S/C18H21F2N3O/c1-13-3-5-15-11-14(12-21-17(15)22-13)4-6-16(24)23-9-2-7-18(19,20)8-10-23/h4,6,11-12H,1-3,5,7-10H2,(H,21,22)/b6-4+ |
| InChIKey | NISWARCDOCZPBM-GQCTYLIASA-N |
| XLogP | 3.61 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|