C19H15F3O4S — CID 90225655
(14-methyl-18-oxatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaen-5-yl) trifluoromethanesulfonate (PubChem CID 90225655) has the molecular formula C19H15F3O4S and a molecular weight of 396.39 g/mol. Its IUPAC name is (14-methyl-18-oxatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaen-5-yl) trifluoromethanesulfonate.
| Compound Name | (14-methyl-18-oxatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaen-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90225655 |
| Molecular Formula | C19H15F3O4S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (14-methyl-18-oxatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaen-5-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2oc3c(c2c1)CCCc1cc(OS(=O)(=O)C(F)(F)F)ccc1-3 |
| InChI | InChI=1S/C19H15F3O4S/c1-11-5-8-17-16(9-11)15-4-2-3-12-10-13(6-7-14(12)18(15)25-17)26-27(23,24)19(20,21)22/h5-10H,2-4H2,1H3 |
| InChIKey | VSYZGNNBBUEMFY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|