About 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine
3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine (PubChem CID 90226227) has the molecular formula C24H16F2N2O2S2
and a molecular weight of 466.53 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine |
| PubChem CID | 90226227 |
| Molecular Formula | C24H16F2N2O2S2 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccc(F)cc3F)c3c(-c4ccsc4)ccnc32)cc1 |
| InChI | InChI=1S/C24H16F2N2O2S2/c1-15-2-5-18(6-3-15)32(29,30)28-13-21(20-7-4-17(25)12-22(20)26)23-19(8-10-27-24(23)28)16-9-11-31-14-16/h2-14H,1H3 |
| InChIKey | VJOJEZUGACDIOC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine?
The IUPAC name of 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine (CID 90226227) is 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine is Cc1ccc(S(=O)(=O)n2cc(-c3ccc(F)cc3F)c3c(-c4ccsc4)ccnc32)cc1.
What is the InChIKey of 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine?
The InChIKey is VJOJEZUGACDIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16F2N2O2S2/c1-15-2-5-18(6-3-15)32(29,30)28-13-21(20-7-4-17(25)12-22(20)26)23-19(8-10-27-24(23)28)16-9-11-31-14-16/h2-14H,1H3.
What are the key properties of 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine?
3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine has a molecular weight of 466.53 g/mol, XLogP of 6.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluorophenyl)-1-(4-methylphenyl)sulfonyl-4-thiophen-3-ylpyrrolo[2,3-b]pyridine is sourced from PubChem (CID 90226227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).