C24H26ClN3O4S2 — CID 90226256
4-chloro-1-[(2Z,4E)-hepta-2,4-dien-4-yl]sulfonyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridine (PubChem CID 90226256) has the molecular formula C24H26ClN3O4S2 and a molecular weight of 520.08 g/mol. Its IUPAC name is 4-chloro-1-[(2Z,4E)-hepta-2,4-dien-4-yl]sulfonyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridine.
| Compound Name | 4-chloro-1-[(2Z,4E)-hepta-2,4-dien-4-yl]sulfonyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 90226256 |
| Molecular Formula | C24H26ClN3O4S2 |
| Molecular Weight | 520.08 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 4-chloro-1-[(2Z,4E)-hepta-2,4-dien-4-yl]sulfonyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridine |
| SMILES | C/C=C\C(=C/CC)S(=O)(=O)n1cc(-c2cccc(S(=O)(=O)N3CCCC3)c2)c2c(Cl)ccnc21 |
| InChI | InChI=1S/C24H26ClN3O4S2/c1-3-8-19(9-4-2)34(31,32)28-17-21(23-22(25)12-13-26-24(23)28)18-10-7-11-20(16-18)33(29,30)27-14-5-6-15-27/h3,7-13,16-17H,4-6,14-15H2,1-2H3/b8-3-,19-9+ |
| InChIKey | MEKGAPVXRQIKAI-WYNOZOFQSA-N |
| XLogP | 5.19 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.08 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|