About 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine
4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 90226324) has the molecular formula C21H18ClN3O4S
and a molecular weight of 443.91 g/mol. Its IUPAC name is 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| PubChem CID | 90226324 |
| Molecular Formula | C21H18ClN3O4S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(-c2cn(S(=O)(=O)c3ccc(C)cc3)c3nccc(Cl)c23)c(OC)n1 |
| InChI | InChI=1S/C21H18ClN3O4S/c1-13-4-6-14(7-5-13)30(26,27)25-12-16(19-17(22)10-11-23-20(19)25)15-8-9-18(28-2)24-21(15)29-3/h4-12H,1-3H3 |
| InChIKey | GNKNIXCFFUESKK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine?
The IUPAC name of 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CID 90226324) is 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
What is the SMILES notation for 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine?
The canonical SMILES for 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine is COc1ccc(-c2cn(S(=O)(=O)c3ccc(C)cc3)c3nccc(Cl)c23)c(OC)n1.
What is the InChIKey of 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine?
The InChIKey is GNKNIXCFFUESKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClN3O4S/c1-13-4-6-14(7-5-13)30(26,27)25-12-16(19-17(22)10-11-23-20(19)25)15-8-9-18(28-2)24-21(15)29-3/h4-12H,1-3H3.
What are the key properties of 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine?
4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine has a molecular weight of 443.91 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(2,6-dimethoxy-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine is sourced from PubChem (CID 90226324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).