About 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane
2,3-bis(2,2-dimethylbutyl)-2-methyloxirane (PubChem CID 90226520) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane.
Molecular Properties
| Compound Name | 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane |
| PubChem CID | 90226520 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane |
| SMILES | CCC(C)(C)CC1OC1(C)CC(C)(C)CC |
| InChI | InChI=1S/C15H30O/c1-8-13(3,4)10-12-15(7,16-12)11-14(5,6)9-2/h12H,8-11H2,1-7H3 |
| InChIKey | VYBWEXYZSUBFEA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane?
The IUPAC name of 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane (CID 90226520) is 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane.
What is the SMILES notation for 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane?
The canonical SMILES for 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane is CCC(C)(C)CC1OC1(C)CC(C)(C)CC.
What is the InChIKey of 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane?
The InChIKey is VYBWEXYZSUBFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O/c1-8-13(3,4)10-12-15(7,16-12)11-14(5,6)9-2/h12H,8-11H2,1-7H3.
What are the key properties of 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane?
2,3-bis(2,2-dimethylbutyl)-2-methyloxirane has a molecular weight of 226.40 g/mol, XLogP of 4.80, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(2,2-dimethylbutyl)-2-methyloxirane is sourced from PubChem (CID 90226520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).