C27H21Cl2F7N2O2 — CID 90226596
4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]naphthalene-1-carboxamide (PubChem CID 90226596) has the molecular formula C27H21Cl2F7N2O2 and a molecular weight of 609.37 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]naphthalene-1-carboxamide.
| Compound Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 90226596 |
| Molecular Formula | C27H21Cl2F7N2O2 |
| Molecular Weight | 609.37 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]naphthalene-1-carboxamide |
| SMILES | CC(C)(NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)c2ccccc12)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C27H21Cl2F7N2O2/c1-25(2,24(40)37-13-26(31,32)33)38-23(39)18-9-7-14(16-5-3-4-6-17(16)18)8-10-19(27(34,35)36)15-11-20(28)22(30)21(29)12-15/h3-12,19H,13H2,1-2H3,(H,37,40)(H,38,39)/b10-8+ |
| InChIKey | MDLFSYREXAADSR-CSKARUKUSA-N |
| XLogP | 7.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.37 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|