C72H49BrN4 — CID 90226949
5-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]-2-bromo-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 90226949) has the molecular formula C72H49BrN4 and a molecular weight of 1050.12 g/mol. Its IUPAC name is 5-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]-2-bromo-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 5-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]-2-bromo-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 90226949 |
| Molecular Formula | C72H49BrN4 |
| Molecular Weight | 1050.12 g/mol |
| Exact Mass | 1048.31 |
| IUPAC Name | 5-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]-2-bromo-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4cc(Br)ccc4n(-c4nc(-c5cccc(-c6cc(-c7ccccc7)cc(-c7ccccc7)c6)c5)nc(-c5cccc(-c6cc(-c7ccccc7)cc(-c7ccccc7)c6)c5)n4)c3cc21 |
| InChI | InChI=1S/C72H49BrN4/c1-72(2)65-32-16-15-31-61(65)62-44-64-63-43-60(73)33-34-67(63)77(68(64)45-66(62)72)71-75-69(52-29-17-27-50(35-52)58-39-54(46-19-7-3-8-20-46)37-55(40-58)47-21-9-4-10-22-47)74-70(76-71)53-30-18-28-51(36-53)59-41-56(48-23-11-5-12-24-48)38-57(42-59)49-25-13-6-14-26-49/h3-45H,1-2H3 |
| InChIKey | BMQBEZWJECCHMT-UHFFFAOYSA-N |
| XLogP | 19.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.12 |
| LogP ≤ 5 | 19.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |