C23H17Cl3F3NO — CID 90227048
N-(1-ethynylcyclopropyl)-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 90227048) has the molecular formula C23H17Cl3F3NO and a molecular weight of 486.75 g/mol. Its IUPAC name is N-(1-ethynylcyclopropyl)-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-(1-ethynylcyclopropyl)-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 90227048 |
| Molecular Formula | C23H17Cl3F3NO |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | N-(1-ethynylcyclopropyl)-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | C#CC1(NC(=O)c2ccc(/C=C/C(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)cc2C)CC1 |
| InChI | InChI=1S/C23H17Cl3F3NO/c1-3-22(8-9-22)30-21(31)16-6-4-14(10-13(16)2)5-7-17(23(27,28)29)15-11-18(24)20(26)19(25)12-15/h1,4-7,10-12,17H,8-9H2,2H3,(H,30,31)/b7-5+ |
| InChIKey | HMRDLSFMPXYRGJ-FNORWQNLSA-N |
| XLogP | 7.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|