C23H18Cl3F6NO — CID 90227227
3,3,3-trifluoro-N-[[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2,3-dihydro-1H-inden-1-yl]methyl]propanamide (PubChem CID 90227227) has the molecular formula C23H18Cl3F6NO and a molecular weight of 544.75 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2,3-dihydro-1H-inden-1-yl]methyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2,3-dihydro-1H-inden-1-yl]methyl]propanamide |
|---|---|
| PubChem CID | 90227227 |
| Molecular Formula | C23H18Cl3F6NO |
| Molecular Weight | 544.75 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | 3,3,3-trifluoro-N-[[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2,3-dihydro-1H-inden-1-yl]methyl]propanamide |
| SMILES | O=C(CC(F)(F)F)NCC1CCc2cc(/C=C/C(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H18Cl3F6NO/c24-18-8-15(9-19(25)21(18)26)17(23(30,31)32)6-2-12-1-5-16-13(7-12)3-4-14(16)11-33-20(34)10-22(27,28)29/h1-2,5-9,14,17H,3-4,10-11H2,(H,33,34)/b6-2+ |
| InChIKey | NEEPKJYELLMZKA-QHHAFSJGSA-N |
| XLogP | 8.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.75 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|