C15H27ClN2O2Si — CID 90227671
(2R,5R)-2-[[1-(chloromethyl)silolan-1-yl]methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 90227671) has the molecular formula C15H27ClN2O2Si and a molecular weight of 330.93 g/mol. Its IUPAC name is (2R,5R)-2-[[1-(chloromethyl)silolan-1-yl]methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2R,5R)-2-[[1-(chloromethyl)silolan-1-yl]methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 90227671 |
| Molecular Formula | C15H27ClN2O2Si |
| Molecular Weight | 330.93 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2R,5R)-2-[[1-(chloromethyl)silolan-1-yl]methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@H]1C[Si]1(CCl)CCCC1 |
| InChI | InChI=1S/C15H27ClN2O2Si/c1-11(2)13-15(20-4)17-12(14(18-13)19-3)9-21(10-16)7-5-6-8-21/h11-13H,5-10H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | XICGKYISQWCXAV-QWHCGFSZSA-N |
| XLogP | 3.50 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|