C19H18O — CID 90227674
5,14-dimethyl-18-oxatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaene (PubChem CID 90227674) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is 5,14-dimethyl-18-oxatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaene.
| Compound Name | 5,14-dimethyl-18-oxatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaene |
|---|---|
| PubChem CID | 90227674 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5,14-dimethyl-18-oxatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaene |
| SMILES | Cc1ccc2c(c1)CCCc1c-2oc2ccc(C)cc12 |
| InChI | InChI=1S/C19H18O/c1-12-6-8-15-14(10-12)4-3-5-16-17-11-13(2)7-9-18(17)20-19(15)16/h6-11H,3-5H2,1-2H3 |
| InChIKey | XFKPZMDVICOAJZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |