C11H7ClN3O2P — CID 90227681
13-chloro-8-phosphanyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-4-carboxylic acid (PubChem CID 90227681) has the molecular formula C11H7ClN3O2P and a molecular weight of 279.62 g/mol. Its IUPAC name is 13-chloro-8-phosphanyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-4-carboxylic acid.
| Compound Name | 13-chloro-8-phosphanyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-4-carboxylic acid |
|---|---|
| PubChem CID | 90227681 |
| Molecular Formula | C11H7ClN3O2P |
| Molecular Weight | 279.62 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 13-chloro-8-phosphanyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-4-carboxylic acid |
| SMILES | O=C(O)c1cc2c3c(Cl)ccnc3n(P)c2cn1 |
| InChI | InChI=1S/C11H7ClN3O2P/c12-6-1-2-13-10-9(6)5-3-7(11(16)17)14-4-8(5)15(10)18/h1-4H,18H2,(H,16,17) |
| InChIKey | MQSJVJVNKHRIIW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|