C24H30F3N3O4 — CID 90228099
(3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-methoxy-2-methylphenyl)-1-(4,4,4-trifluorobutyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione (PubChem CID 90228099) has the molecular formula C24H30F3N3O4 and a molecular weight of 481.52 g/mol. Its IUPAC name is (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-methoxy-2-methylphenyl)-1-(4,4,4-trifluorobutyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-methoxy-2-methylphenyl)-1-(4,4,4-trifluorobutyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 90228099 |
| Molecular Formula | C24H30F3N3O4 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-methoxy-2-methylphenyl)-1-(4,4,4-trifluorobutyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc(C)c([C@]23CC4CN(CCCC(F)(F)F)[C@H]4[C@]2(O)CC[C@@]2(C3)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C24H30F3N3O4/c1-14-4-5-16(34-2)10-17(14)21-11-15-12-30(9-3-6-24(25,26)27)18(15)23(21,33)8-7-22(13-21)19(31)28-20(32)29-22/h4-5,10,15,18,33H,3,6-9,11-13H2,1-2H3,(H2,28,29,31,32)/t15?,18-,21-,22+,23-/m1/s1 |
| InChIKey | FHNQGOXFEYTCEP-AXGDNVBPSA-N |
| XLogP | 2.78 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|