C22H26F3N3O4 — CID 90228102
(3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(3,3,3-trifluoropropyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione (PubChem CID 90228102) has the molecular formula C22H26F3N3O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(3,3,3-trifluoropropyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(3,3,3-trifluoropropyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 90228102 |
| Molecular Formula | C22H26F3N3O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (3aR,5S,7aS,7bR)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(3,3,3-trifluoropropyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(O)cc1[C@]12CC3CN(CCC(F)(F)F)[C@H]3[C@]1(O)CC[C@@]1(C2)NC(=O)NC1=O |
| InChI | InChI=1S/C22H26F3N3O4/c1-12-2-3-14(29)8-15(12)19-9-13-10-28(7-6-22(23,24)25)16(13)21(19,32)5-4-20(11-19)17(30)26-18(31)27-20/h2-3,8,13,16,29,32H,4-7,9-11H2,1H3,(H2,26,27,30,31)/t13?,16-,19-,20+,21-/m1/s1 |
| InChIKey | ZEOLYOACXSITDG-BZQIATGLSA-N |
| XLogP | 2.09 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|