C35H44ClN9O2 — CID 90228239
3,5-diamino-6-chloro-N-[N'-[4-[4-[(2S)-3-[4-[3-(dimethylamino)propyl]anilino]-2-methyl-3-oxopropyl]naphthalen-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 90228239) has the molecular formula C35H44ClN9O2 and a molecular weight of 658.25 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2S)-3-[4-[3-(dimethylamino)propyl]anilino]-2-methyl-3-oxopropyl]naphthalen-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2S)-3-[4-[3-(dimethylamino)propyl]anilino]-2-methyl-3-oxopropyl]naphthalen-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90228239 |
| Molecular Formula | C35H44ClN9O2 |
| Molecular Weight | 658.25 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2S)-3-[4-[3-(dimethylamino)propyl]anilino]-2-methyl-3-oxopropyl]naphthalen-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C[C@@H](Cc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)c2ccccc12)C(=O)Nc1ccc(CCCN(C)C)cc1 |
| InChI | InChI=1S/C35H44ClN9O2/c1-22(33(46)41-26-17-13-23(14-18-26)9-8-20-45(2)3)21-25-16-15-24(27-11-4-5-12-28(25)27)10-6-7-19-40-35(39)44-34(47)29-31(37)43-32(38)30(36)42-29/h4-5,11-18,22H,6-10,19-21H2,1-3H3,(H,41,46)(H4,37,38,43)(H3,39,40,44,47)/t22-/m0/s1 |
| InChIKey | GLYMVLOWFBMQMQ-QFIPXVFZSA-N |
| XLogP | 4.83 |
| TPSA | 177.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|