C38H50ClN9O2 — CID 90228245
3,5-diamino-6-chloro-N-[N'-[4-[4-[(2S)-3-[4-[6-(dimethylamino)hexyl]anilino]-2-methyl-3-oxopropyl]naphthalen-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 90228245) has the molecular formula C38H50ClN9O2 and a molecular weight of 700.33 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2S)-3-[4-[6-(dimethylamino)hexyl]anilino]-2-methyl-3-oxopropyl]naphthalen-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2S)-3-[4-[6-(dimethylamino)hexyl]anilino]-2-methyl-3-oxopropyl]naphthalen-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90228245 |
| Molecular Formula | C38H50ClN9O2 |
| Molecular Weight | 700.33 g/mol |
| Exact Mass | 699.38 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2S)-3-[4-[6-(dimethylamino)hexyl]anilino]-2-methyl-3-oxopropyl]naphthalen-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C[C@@H](Cc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)c2ccccc12)C(=O)Nc1ccc(CCCCCCN(C)C)cc1 |
| InChI | InChI=1S/C38H50ClN9O2/c1-25(36(49)44-29-20-16-26(17-21-29)12-6-4-5-11-23-48(2)3)24-28-19-18-27(30-14-7-8-15-31(28)30)13-9-10-22-43-38(42)47-37(50)32-34(40)46-35(41)33(39)45-32/h7-8,14-21,25H,4-6,9-13,22-24H2,1-3H3,(H,44,49)(H4,40,41,46)(H3,42,43,47,50)/t25-/m0/s1 |
| InChIKey | GYOIBUJTMMOADZ-VWLOTQADSA-N |
| XLogP | 6.00 |
| TPSA | 177.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|