C15H30N3+ — CID 90228418
1,9-ditert-butyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-5-ium (PubChem CID 90228418) has the molecular formula C15H30N3+ and a molecular weight of 252.43 g/mol. Its IUPAC name is 1,9-ditert-butyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-5-ium.
| Compound Name | 1,9-ditert-butyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-5-ium |
|---|---|
| PubChem CID | 90228418 |
| Molecular Formula | C15H30N3+ |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.24 |
| IUPAC Name | 1,9-ditert-butyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-5-ium |
| SMILES | CC(C)(C)N1CCC[N+]2=C1N(C(C)(C)C)CCC2 |
| InChI | InChI=1S/C15H30N3/c1-14(2,3)17-11-7-9-16-10-8-12-18(13(16)17)15(4,5)6/h7-12H2,1-6H3/q+1 |
| InChIKey | OBJKIFMEIBERQY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|