C25H30F3N3O4 — CID 90228467
(3aR,5S,7aS,7bR)-1-(cyclopropylmethyl)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1'-(2,2,2-trifluoroethyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione (PubChem CID 90228467) has the molecular formula C25H30F3N3O4 and a molecular weight of 493.53 g/mol. Its IUPAC name is (3aR,5S,7aS,7bR)-1-(cyclopropylmethyl)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1'-(2,2,2-trifluoroethyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3aR,5S,7aS,7bR)-1-(cyclopropylmethyl)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1'-(2,2,2-trifluoroethyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 90228467 |
| Molecular Formula | C25H30F3N3O4 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | (3aR,5S,7aS,7bR)-1-(cyclopropylmethyl)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1'-(2,2,2-trifluoroethyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(O)cc1[C@]12CC3CN(CC4CC4)[C@H]3[C@]1(O)CC[C@]1(C2)C(=O)NC(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C25H30F3N3O4/c1-14-2-5-17(32)8-18(14)22-9-16-11-30(10-15-3-4-15)19(16)24(22,35)7-6-23(12-22)20(33)29-21(34)31(23)13-25(26,27)28/h2,5,8,15-16,19,32,35H,3-4,6-7,9-13H2,1H3,(H,29,33,34)/t16?,19-,22-,23+,24-/m1/s1 |
| InChIKey | VBXLVEXWNDRQKL-ICJYOWLTSA-N |
| XLogP | 2.82 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|