About hydron;methyl N'-aminocarbamimidothioate;iodide
hydron;methyl N'-aminocarbamimidothioate;iodide (PubChem CID 90229300) has the molecular formula C2H8IN3S
and a molecular weight of 233.08 g/mol. Its IUPAC name is hydron;methyl N'-aminocarbamimidothioate;iodide.
Molecular Properties
| Compound Name | hydron;methyl N'-aminocarbamimidothioate;iodide |
| PubChem CID | 90229300 |
| Molecular Formula | C2H8IN3S |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | hydron;methyl N'-aminocarbamimidothioate;iodide |
| SMILES | CS/C(N)=N\N.[H+].[I-] |
| InChI | InChI=1S/C2H7N3S.HI/c1-6-2(3)5-4;/h4H2,1H3,(H2,3,5);1H |
| InChIKey | NYMQJWVULPQXBK-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydron;methyl N'-aminocarbamimidothioate;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;methyl N'-aminocarbamimidothioate;iodide?
The IUPAC name of hydron;methyl N'-aminocarbamimidothioate;iodide (CID 90229300) is hydron;methyl N'-aminocarbamimidothioate;iodide.
What is the SMILES notation for hydron;methyl N'-aminocarbamimidothioate;iodide?
The canonical SMILES for hydron;methyl N'-aminocarbamimidothioate;iodide is CS/C(N)=N\N.[H+].[I-].
What is the InChIKey of hydron;methyl N'-aminocarbamimidothioate;iodide?
The InChIKey is NYMQJWVULPQXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3S.HI/c1-6-2(3)5-4;/h4H2,1H3,(H2,3,5);1H.
What are the key properties of hydron;methyl N'-aminocarbamimidothioate;iodide?
hydron;methyl N'-aminocarbamimidothioate;iodide has a molecular weight of 233.08 g/mol, XLogP of -3.35, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;methyl N'-aminocarbamimidothioate;iodide is sourced from PubChem (CID 90229300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).