C25H25N3O4S — CID 90230068
N-[3-(1-methyl-2-oxoquinolin-6-yl)oxypropyl]-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 90230068) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[3-(1-methyl-2-oxoquinolin-6-yl)oxypropyl]-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | N-[3-(1-methyl-2-oxoquinolin-6-yl)oxypropyl]-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90230068 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[3-(1-methyl-2-oxoquinolin-6-yl)oxypropyl]-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | Cn1c(=O)ccc2cc(OCCCN(Cc3cccnc3)S(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C25H25N3O4S/c1-27-24-12-11-22(17-21(24)10-13-25(27)29)32-16-6-15-28(19-20-7-5-14-26-18-20)33(30,31)23-8-3-2-4-9-23/h2-5,7-14,17-18H,6,15-16,19H2,1H3 |
| InChIKey | XAVVTUIJVRNJIZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|