About (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide
(2Z)-2-(hydroxymethyl)hexa-2,5-dienamide (PubChem CID 90230508) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide.
Molecular Properties
| Compound Name | (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide |
| PubChem CID | 90230508 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide |
| SMILES | C=CC/C=C(/CO)C(N)=O |
| InChI | InChI=1S/C7H11NO2/c1-2-3-4-6(5-9)7(8)10/h2,4,9H,1,3,5H2,(H2,8,10)/b6-4- |
| InChIKey | FZBQHOHAOQNJGO-XQRVVYSFSA-N |
| XLogP | -0.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide?
The IUPAC name of (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide (CID 90230508) is (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide.
What is the SMILES notation for (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide?
The canonical SMILES for (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide is C=CC/C=C(/CO)C(N)=O.
What is the InChIKey of (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide?
The InChIKey is FZBQHOHAOQNJGO-XQRVVYSFSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-3-4-6(5-9)7(8)10/h2,4,9H,1,3,5H2,(H2,8,10)/b6-4-.
What are the key properties of (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide?
(2Z)-2-(hydroxymethyl)hexa-2,5-dienamide has a molecular weight of 141.17 g/mol, XLogP of -0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(hydroxymethyl)hexa-2,5-dienamide is sourced from PubChem (CID 90230508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).