C18H21N5O2 — CID 90230660
(3R)-3,13-dimethyl-15-(3-methylazetidin-3-yl)-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,13,16-pentaen-4-one (PubChem CID 90230660) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (3R)-3,13-dimethyl-15-(3-methylazetidin-3-yl)-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,13,16-pentaen-4-one.
| Compound Name | (3R)-3,13-dimethyl-15-(3-methylazetidin-3-yl)-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,13,16-pentaen-4-one |
|---|---|
| PubChem CID | 90230660 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (3R)-3,13-dimethyl-15-(3-methylazetidin-3-yl)-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,13,16-pentaen-4-one |
| SMILES | Cc1cn(C2(C)CNC2)c2cc3c(cc12)OCC1=NNC(=O)[C@@H](C)N13 |
| InChI | InChI=1S/C18H21N5O2/c1-10-6-22(18(3)8-19-9-18)13-5-14-15(4-12(10)13)25-7-16-20-21-17(24)11(2)23(14)16/h4-6,11,19H,7-9H2,1-3H3,(H,21,24)/t11-/m1/s1 |
| InChIKey | GVVVNTHSEFWQKZ-LLVKDONJSA-N |
| XLogP | 1.30 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |