C25H31N5O3 — CID 90230667
(1R)-9-[(1,3-dimethylazetidin-3-yl)-methylamino]-8-[2-(methoxymethyl)phenyl]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 90230667) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is (1R)-9-[(1,3-dimethylazetidin-3-yl)-methylamino]-8-[2-(methoxymethyl)phenyl]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | (1R)-9-[(1,3-dimethylazetidin-3-yl)-methylamino]-8-[2-(methoxymethyl)phenyl]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 90230667 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (1R)-9-[(1,3-dimethylazetidin-3-yl)-methylamino]-8-[2-(methoxymethyl)phenyl]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | COCc1ccccc1-c1cc2c(cc1N(C)C1(C)CN(C)C1)N1C(=NNC(=O)[C@H]1C)CO2 |
| InChI | InChI=1S/C25H31N5O3/c1-16-24(31)27-26-23-13-33-22-10-19(18-9-7-6-8-17(18)12-32-5)20(11-21(22)30(16)23)29(4)25(2)14-28(3)15-25/h6-11,16H,12-15H2,1-5H3,(H,27,31)/t16-/m1/s1 |
| InChIKey | GGYDKNCTAXHBMZ-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|