C26H28N2 — CID 90231033
4-[(1E,3Z)-hexa-1,3,5-trienyl]-7-[(3Z)-hexa-1,3,5-trien-2-yl]-2,9-dimethyl-1,6a,10a,10b-tetrahydro-1,10-phenanthroline (PubChem CID 90231033) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 4-[(1E,3Z)-hexa-1,3,5-trienyl]-7-[(3Z)-hexa-1,3,5-trien-2-yl]-2,9-dimethyl-1,6a,10a,10b-tetrahydro-1,10-phenanthroline.
| Compound Name | 4-[(1E,3Z)-hexa-1,3,5-trienyl]-7-[(3Z)-hexa-1,3,5-trien-2-yl]-2,9-dimethyl-1,6a,10a,10b-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 90231033 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 4-[(1E,3Z)-hexa-1,3,5-trienyl]-7-[(3Z)-hexa-1,3,5-trien-2-yl]-2,9-dimethyl-1,6a,10a,10b-tetrahydro-1,10-phenanthroline |
| SMILES | C=C/C=C\C=C\C1=C2C=CC3C(C(=C)/C=C\C=C)=CC(C)=NC3C2NC(C)=C1 |
| InChI | InChI=1S/C26H28N2/c1-6-8-10-11-13-21-16-19(4)27-25-22(21)14-15-23-24(18(3)12-9-7-2)17-20(5)28-26(23)25/h6-17,23,25-27H,1-3H2,4-5H3/b10-8-,12-9-,13-11+ |
| InChIKey | WYMBRYJZKDQHJG-MBKGXSFUSA-N |
| XLogP | 5.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|