C24H29N3O4 — CID 90231114
(1R,10S,11R)-10-hydroxy-1-(5-hydroxy-2-methylphenyl)-N,N,12-trimethyl-5-oxo-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-diene-6-carboxamide (PubChem CID 90231114) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (1R,10S,11R)-10-hydroxy-1-(5-hydroxy-2-methylphenyl)-N,N,12-trimethyl-5-oxo-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-diene-6-carboxamide.
| Compound Name | (1R,10S,11R)-10-hydroxy-1-(5-hydroxy-2-methylphenyl)-N,N,12-trimethyl-5-oxo-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-diene-6-carboxamide |
|---|---|
| PubChem CID | 90231114 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (1R,10S,11R)-10-hydroxy-1-(5-hydroxy-2-methylphenyl)-N,N,12-trimethyl-5-oxo-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-diene-6-carboxamide |
| SMILES | Cc1ccc(O)cc1[C@@]12Cc3[nH]c(=O)c(C(=O)N(C)C)cc3C[C@@]1(O)[C@H]1C(CN1C)C2 |
| InChI | InChI=1S/C24H29N3O4/c1-13-5-6-16(28)8-18(13)23-9-15-12-27(4)20(15)24(23,31)10-14-7-17(22(30)26(2)3)21(29)25-19(14)11-23/h5-8,15,20,28,31H,9-12H2,1-4H3,(H,25,29)/t15?,20-,23-,24-/m1/s1 |
| InChIKey | PCWVVOJRCVIZCN-VIAVUASDSA-N |
| XLogP | 1.19 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |