C12H18N2 — CID 90231344
(1Z,3Z)-1-(5-methyl-1,2-dihydropyridin-6-yl)hexa-1,3-dien-3-amine (PubChem CID 90231344) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (1Z,3Z)-1-(5-methyl-1,2-dihydropyridin-6-yl)hexa-1,3-dien-3-amine.
| Compound Name | (1Z,3Z)-1-(5-methyl-1,2-dihydropyridin-6-yl)hexa-1,3-dien-3-amine |
|---|---|
| PubChem CID | 90231344 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (1Z,3Z)-1-(5-methyl-1,2-dihydropyridin-6-yl)hexa-1,3-dien-3-amine |
| SMILES | CC/C=C(N)/C=C\C1=C(C)C=CCN1 |
| InChI | InChI=1S/C12H18N2/c1-3-5-11(13)7-8-12-10(2)6-4-9-14-12/h4-8,14H,3,9,13H2,1-2H3/b8-7-,11-5- |
| InChIKey | ZLUPSDSEMPRCAE-RNNYEWFJSA-N |
| XLogP | 2.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|