C26H37Cl2N5O2 — CID 90232136
(2R,5R)-1-[2-(6-benzyl-3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-2-oxoethyl]-N,N,5-trimethylpiperazine-2-carboxamide;dihydrochloride (PubChem CID 90232136) has the molecular formula C26H37Cl2N5O2 and a molecular weight of 522.52 g/mol. Its IUPAC name is (2R,5R)-1-[2-(6-benzyl-3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-2-oxoethyl]-N,N,5-trimethylpiperazine-2-carboxamide;dihydrochloride.
| Compound Name | (2R,5R)-1-[2-(6-benzyl-3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-2-oxoethyl]-N,N,5-trimethylpiperazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 90232136 |
| Molecular Formula | C26H37Cl2N5O2 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (2R,5R)-1-[2-(6-benzyl-3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-2-oxoethyl]-N,N,5-trimethylpiperazine-2-carboxamide;dihydrochloride |
| SMILES | C[C@@H]1CN(CC(=O)N2CC(C)(C)c3ncc(Cc4ccccc4)cc32)[C@@H](C(=O)N(C)C)CN1.Cl.Cl |
| InChI | InChI=1S/C26H35N5O2.2ClH/c1-18-15-30(22(14-27-18)25(33)29(4)5)16-23(32)31-17-26(2,3)24-21(31)12-20(13-28-24)11-19-9-7-6-8-10-19;;/h6-10,12-13,18,22,27H,11,14-17H2,1-5H3;2*1H/t18-,22-;;/m1../s1 |
| InChIKey | ONHMJBSOSWPDAC-VMJMSTHCSA-N |
| XLogP | 2.89 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |