About benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid
benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid (PubChem CID 90232337) has the molecular formula C22H24N2O5
and a molecular weight of 396.44 g/mol. Its IUPAC name is benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid.
Molecular Properties
| Compound Name | benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid |
| PubChem CID | 90232337 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid |
| SMILES | CC(C)OCC(CN(Cc1ccccc1)C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H24N2O5/c1-15(2)29-14-17(13-23(22(27)28)12-16-8-4-3-5-9-16)24-20(25)18-10-6-7-11-19(18)21(24)26/h3-11,15,17H,12-14H2,1-2H3,(H,27,28) |
| InChIKey | HISIBNHYVQKMTC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid?
The IUPAC name of benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid (CID 90232337) is benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid.
What is the SMILES notation for benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid?
The canonical SMILES for benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid is CC(C)OCC(CN(Cc1ccccc1)C(=O)O)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid?
The InChIKey is HISIBNHYVQKMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O5/c1-15(2)29-14-17(13-23(22(27)28)12-16-8-4-3-5-9-16)24-20(25)18-10-6-7-11-19(18)21(24)26/h3-11,15,17H,12-14H2,1-2H3,(H,27,28).
What are the key properties of benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid?
benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid has a molecular weight of 396.44 g/mol, XLogP of 3.26, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[2-(1,3-dioxoisoindol-2-yl)-3-propan-2-yloxypropyl]carbamic acid is sourced from PubChem (CID 90232337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).