C23H26F4N4O2 — CID 90232791
N-(2-amino-2-methylpentyl)-2,6-dimethyl-8-[(2,3,5,6-tetrafluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 90232791) has the molecular formula C23H26F4N4O2 and a molecular weight of 466.48 g/mol. Its IUPAC name is N-(2-amino-2-methylpentyl)-2,6-dimethyl-8-[(2,3,5,6-tetrafluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(2-amino-2-methylpentyl)-2,6-dimethyl-8-[(2,3,5,6-tetrafluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90232791 |
| Molecular Formula | C23H26F4N4O2 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-(2-amino-2-methylpentyl)-2,6-dimethyl-8-[(2,3,5,6-tetrafluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCCC(C)(N)CNC(=O)c1c(C)nc2c(OCc3c(F)c(F)cc(F)c3F)cc(C)cn12 |
| InChI | InChI=1S/C23H26F4N4O2/c1-5-6-23(4,28)11-29-22(32)20-13(3)30-21-17(7-12(2)9-31(20)21)33-10-14-18(26)15(24)8-16(25)19(14)27/h7-9H,5-6,10-11,28H2,1-4H3,(H,29,32) |
| InChIKey | CALBULWIXSYPPI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|