C25H26ClN3O3S — CID 90233741
1-(4-chlorophenyl)-4-(2-phenylethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazolidine-3-thione (PubChem CID 90233741) has the molecular formula C25H26ClN3O3S and a molecular weight of 484.02 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(2-phenylethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 1-(4-chlorophenyl)-4-(2-phenylethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 90233741 |
| Molecular Formula | C25H26ClN3O3S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(2-phenylethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazolidine-3-thione |
| SMILES | COc1cc(C2N(CCc3ccccc3)C(=S)NN2c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26ClN3O3S/c1-30-21-15-18(16-22(31-2)23(21)32-3)24-28(14-13-17-7-5-4-6-8-17)25(33)27-29(24)20-11-9-19(26)10-12-20/h4-12,15-16,24H,13-14H2,1-3H3,(H,27,33) |
| InChIKey | YGJQFIACRXAQLP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|