About 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile
5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile (PubChem CID 90234558) has the molecular formula C16H14N4O2S
and a molecular weight of 326.38 g/mol. Its IUPAC name is 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile |
| PubChem CID | 90234558 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile |
| SMILES | Cc1noc(C)c1-c1cc(N)c(=O)n(Cc2ccc(C#N)s2)c1 |
| InChI | InChI=1S/C16H14N4O2S/c1-9-15(10(2)22-19-9)11-5-14(18)16(21)20(7-11)8-13-4-3-12(6-17)23-13/h3-5,7H,8,18H2,1-2H3 |
| InChIKey | ZSSWKBRNCBCIFS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile?
The IUPAC name of 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile (CID 90234558) is 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile.
What is the SMILES notation for 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile?
The canonical SMILES for 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile is Cc1noc(C)c1-c1cc(N)c(=O)n(Cc2ccc(C#N)s2)c1.
What is the InChIKey of 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile?
The InChIKey is ZSSWKBRNCBCIFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O2S/c1-9-15(10(2)22-19-9)11-5-14(18)16(21)20(7-11)8-13-4-3-12(6-17)23-13/h3-5,7H,8,18H2,1-2H3.
What are the key properties of 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile?
5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile has a molecular weight of 326.38 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1-pyridinyl]methyl]thiophene-2-carbonitrile is sourced from PubChem (CID 90234558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).