C7H11F2NO — CID 90234749
(4aS,7aS)-6,6-difluoro-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 90234749) has the molecular formula C7H11F2NO and a molecular weight of 163.17 g/mol. Its IUPAC name is (4aS,7aS)-6,6-difluoro-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6,6-difluoro-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 90234749 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (4aS,7aS)-6,6-difluoro-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | FC1(F)C[C@@H]2NCCO[C@H]2C1 |
| InChI | InChI=1S/C7H11F2NO/c8-7(9)3-5-6(4-7)11-2-1-10-5/h5-6,10H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | JXGBZSGUAKQWCW-WDSKDSINSA-N |
| XLogP | 0.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |