C18H17F2N3O3S — CID 90235952
2-(1-aminoethyl)-3-[3-(difluoromethyl)phenyl]-5-methylsulfonylquinazolin-4-one (PubChem CID 90235952) has the molecular formula C18H17F2N3O3S and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-(1-aminoethyl)-3-[3-(difluoromethyl)phenyl]-5-methylsulfonylquinazolin-4-one.
| Compound Name | 2-(1-aminoethyl)-3-[3-(difluoromethyl)phenyl]-5-methylsulfonylquinazolin-4-one |
|---|---|
| PubChem CID | 90235952 |
| Molecular Formula | C18H17F2N3O3S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-(1-aminoethyl)-3-[3-(difluoromethyl)phenyl]-5-methylsulfonylquinazolin-4-one |
| SMILES | CC(N)c1nc2cccc(S(C)(=O)=O)c2c(=O)n1-c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C18H17F2N3O3S/c1-10(21)17-22-13-7-4-8-14(27(2,25)26)15(13)18(24)23(17)12-6-3-5-11(9-12)16(19)20/h3-10,16H,21H2,1-2H3 |
| InChIKey | FLOMPPJMXGOESJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |